PRODUCT Properties
| Melting point: | 153-154°C |
| Density | 1.406 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 11.45±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 645512 |
| InChI | InChI=1S/C7H7N3O3/c8-9-7(11)5-2-1-3-6(4-5)10(12)13/h1-4H,8H2,(H,9,11) |
| InChIKey | NQEWXLVDAVTOHM-UHFFFAOYSA-N |
| SMILES | C(NN)(=O)C1=CC=CC([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 618-94-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 3-nitro-, hydrazide (618-94-0) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29280000 |
