A6288712
<i>N</i>,<i>N</i>-Dimethylaminomethylferrocene , 97% , 1271-86-9
Synonym(s):
(Ferrocenylmethyl)dimethylamine;Ferrocenemethylamine;N,N-Dimethylferrocenylmethylamine
CAS NO.:1271-86-9
Empirical Formula: C13H17FeN10*
Molecular Weight: 243.13
MDL number: MFCD00001433
EINECS: 215-044-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB93.60 | In Stock |
|
| 25G | RMB388.00 | In Stock |
|
| 100g | RMB1505.60 | In Stock |
|
| 500g | RMB6079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65 °C |
| Boiling point: | 124-128 °C2.5 mm Hg(lit.) |
| Density | 1.228 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Difficult to mix. |
| form | liquid |
| color | amber |
| InChI | InChI=1S/C8H12N.C5H5.Fe/c1-9(2)7-8-5-3-4-6-8;1-2-4-5-3-1;/h3-6H,7H2,1-2H3;1-5H; |
| InChIKey | JJJSTEANRWLZBH-UHFFFAOYSA-N |
| SMILES | [C]1(CN(C)C)[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe] |^1:0,5,6,7,8,9,10,11,12,13| |
| CAS DataBase Reference | 1271-86-9 |
| EPA Substance Registry System | Ferrocene, [(dimethylamino)methyl]- (1271-86-9) |
Description and Uses
(Dimethylaminomethyl)ferrocene is used as an active pharmaceutical ingredient.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P280g-P305+P351+P338 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |



