PRODUCT Properties
| Melting point: | 229°C |
| Boiling point: | 413.4°C (rough estimate) |
| Density | 1.1764 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| form | powder to crystal |
| color | Orange to Brown to Dark purple |
| Water Solubility | 0.5406ug/L(25 ºC) |
| Henry's Law Constant | 1.5×102 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| InChI | InChI=1S/C14H14N4O2/c1-17(2)13-7-3-11(4-8-13)15-16-12-5-9-14(10-6-12)18(19)20/h3-10H,1-2H3 |
| InChIKey | LSFRFLVWCKLQTO-UHFFFAOYSA-N |
| SMILES | C1(N(C)C)=CC=C(N=NC2=CC=C([N+]([O-])=O)C=C2)C=C1 |
| EPA Substance Registry System | Benzenamine, N,N-dimethyl-4-[(4-nitrophenyl)azo]- (2491-74-9) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| TSCA | TSCA listed |
| HS Code | 2927.00.5000 |



![N,N-diethyl-4-[(2-methoxy-4-nitrophenyl)azo]aniline](https://img.chemicalbook.com/CAS/GIF/6373-95-1.gif)



