A6307912
5-Nitroanthranilic Acid , >98.0%(T) , 616-79-5
Synonym(s):
5-Nitroanthranilic acid
CAS NO.：616-79-5
Empirical Formula: C7H6N2O4
Molecular Weight: 182.13
MDL number: MFCD00017039
EINECS: 210-493-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB44.80 | In Stock |
|
| 100G | RMB156.00 | In Stock |
|
| 500g | RMB576.80 | In Stock |
|
| 2.5kg | RMB2719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270 °C (dec.) (lit.) |
| Boiling point: | 315.51°C (rough estimate) |
| Density | 1.5181 (rough estimate) |
| refractive index | 1.5880 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Insoluble |
| pka | 4.08±0.10(Predicted) |
| form | Powder |
| color | Bright yellow |
| Water Solubility | Insoluble |
| BRN | 646219 |
| InChI | InChI=1S/C7H6N2O4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,8H2,(H,10,11) |
| InChIKey | RUCHWTKMOWXHLU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC([N+]([O-])=O)=CC=C1N |
| CAS DataBase Reference | 616-79-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2-amino-5-nitro- (616-79-5) |
Description and Uses
2-Amino-5-nitrobenzoic acid, is used as an intermediate for dyes and pharmaceuticals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 2 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
