A6312312
Nicergoline , >98.0%(HPLC)(T) , 27848-84-6
Synonym(s):
5-Bromonicotinic acid 10-methoxy-1,6-dimethylergoline-8-methyl ester;Nicergoline
CAS NO.：27848-84-6
Empirical Formula: C24H26BrN3O3
Molecular Weight: 484.39
MDL number: MFCD00869626
EINECS: 248-694-6
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB231.20 | In Stock |
|
| 500mg | RMB959.20 | In Stock |
|
| 1G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-138° |
| Boiling point: | 594.4±50.0 °C(Predicted) |
| Density | 1.3558 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Practically insoluble in water, freely soluble in methylene chloride, soluble in ethanol (96 per cent). |
| form | Solid |
| pka | 6.33±0.40(Predicted) |
| color | White to Off-White |
| Water Solubility | Soluble in alcohol, chloroform, and acetone. Insoluble in water. |
| Merck | 14,9496 |
| InChIKey | YSEXMKHXIOCEJA-AQDCORRGNA-N |
| SMILES | O([C@]12C[C@@H](COC(C3=CN=CC(Br)=C3)=O)CN(C)[C@]1([H])CC1=CN(C)C3=CC=CC2=C13)C |&1:1,3,18,r| |
Description and Uses
antipsychotic
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | KE6341000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29396100 |
| Toxicity | LD50 in male mice, rats (mg/kg): 860, 2800 orally; 46, 43 i.v. (Neumann, Lauschner) |
