A6312412
1,4,5,8-Naphthalenetetracarboxylic Acid (contains Monoanhydride) , >60.0%(NMR) , 128-97-2
CAS NO.:128-97-2
Empirical Formula: C14H8O8
Molecular Weight: 304.21
MDL number: MFCD00004012
EINECS: 204-924-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.80 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 10G | RMB55.20 | In Stock |
|
| 50G | RMB191.20 | In Stock |
|
| 100G | RMB319.20 | In Stock |
|
| 250G | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180 °C |
| Boiling point: | 405.05°C (rough estimate) |
| Density | 1.5387 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| pka | 1.03±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C14H8O8/c15-11(16)5-1-2-6(12(17)18)10-8(14(21)22)4-3-7(9(5)10)13(19)20/h1-4H,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | OLAPPGSPBNVTRF-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=C2C(C(C(O)=O)=CC=C2C(O)=O)=C(C(O)=O)C=C1 |
| CAS DataBase Reference | 128-97-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4,5,8-Naphthalenetetracarboxylic acid(128-97-2) |
| EPA Substance Registry System | 1,4,5,8-Naphthalenetetracarboxylic acid (128-97-2) |
Description and Uses
1,4,5,8-Naphthalenetetracarboxylic acid is a carboxylic acid organic compound and can be used as an intermediate for dyes, pigments, resins, etc.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | QK3690000 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Toxicity | mouse,LD50,oral,3800mg/kg (3800mg/kg),"Toxicometric Parameters of Industrial Toxic Chemicals Under Single Exposure," Izmerov, N.F., et al., Moscow, Centre of International Projects, GKNT, 1982Vol. -, Pg. 90, 1982. |



