A6314112
<i>N</i>-Methoxy-<i>N</i>-methylacetamide , >98.0%(GC) , 78191-00-1
CAS NO.：78191-00-1
Empirical Formula: C4H9NO2
Molecular Weight: 103.12
MDL number: MFCD00060098
EINECS: 628-920-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB83.20 | In Stock |
|
| 100G | RMB315.20 | In Stock |
|
| 500g | RMB1258.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 152 °C (lit.) |
| Density | 0.97 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 121 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Colorless |
| Water Solubility | Soluble |
| InChI | InChI=1S/C4H9NO2/c1-4(6)5(2)7-3/h1-3H3 |
| InChIKey | OYVXVLSZQHSNDK-UHFFFAOYSA-N |
| SMILES | C(N(OC)C)(=O)C |
| CAS DataBase Reference | 78191-00-1(CAS DataBase Reference) |
Description and Uses
N-Methoxy-N-methylacetamide, is a Weinreb amide used in the synthesis of marine natural products myriaporone and usneoidone as a ketone synthon.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P233-P240-P241-P242-P243 |
| Risk Statements | 10 |
| Safety Statements | 16-24/25 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29280000 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
