A6323312
<i>N</i>,<i>O</i>-Bis(<i>tert</i>-butoxycarbonyl)hydroxylamine , ≥98.0% , 85006-25-3
Synonym(s):
N,O-Bis(tert-butoxycarbonyl)hydroxylamine;tert-Butyl N-(tert-butoxycarbonyloxy)carbamate
CAS NO.：85006-25-3
Empirical Formula: C10H19NO5
Molecular Weight: 233.26
MDL number: MFCD00034797
EINECS: 285-055-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.32 | In Stock |
|
| 5G | RMB120.00 | In Stock |
|
| 10g | RMB245.44 | In Stock |
|
| 25g | RMB444.80 | In Stock |
|
| 100g | RMB1240.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-70 °C(lit.) |
| Density | 1.080 |
| storage temp. | -20°C |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 1794022 |
| InChI | 1S/C10H19NO5/c1-9(2,3)14-7(12)11-16-8(13)15-10(4,5)6/h1-6H3,(H,11,12) |
| InChIKey | AGOSGCWATIJZHQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NOC(=O)OC(C)(C)C |
| CAS DataBase Reference | 85006-25-3 |
Description and Uses
N,O-Di-Boc-hydroxylamine (N,O-Bis(tert-butoxycarbonyl)hydroxylamine) may be used for the synthesis of the following:
- 5-lipoxygenase inhibitor LY280810
- hydroxylamines
- hydroxamic acids,
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29241900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
