A6323612
<i>N</i>-Ethyl-<i>p</i>-toluenesulfonamide , >98.0% , 80-39-7
CAS NO.:80-39-7
Empirical Formula: C9H13NO2S
Molecular Weight: 199.27
MDL number: MFCD00048511
EINECS: 201-275-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB40.80 | In Stock |
|
| 100G | RMB112.80 | In Stock |
|
| 500G | RMB331.20 | In Stock |
|
| 2.5kg | RMB1092.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63-65 °C(lit.) |
| Boiling point: | 208 °C745 mm Hg(lit.) |
| Density | 1.26 g/cm3 |
| refractive index | 1.5270 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 11.86±0.50(Predicted) |
| form | Solid |
| color | White to Off-White |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | FILM FORMING PLASTICISER |
| InChI | InChI=1S/C9H13NO2S/c1-3-10-13(11,12)9-6-4-8(2)5-7-9/h4-7,10H,3H2,1-2H3 |
| InChIKey | OHPZPBNDOVQJMH-UHFFFAOYSA-N |
| SMILES | C1(S(NCC)(=O)=O)=CC=C(C)C=C1 |
| LogP | 1.960 (est) |
| CAS DataBase Reference | 80-39-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Toluenesulfonamide, n-ethyl-(80-39-7) |
| EPA Substance Registry System | N-Ethyl-p-toluenesulfonamide (80-39-7) |
Description and Uses
N-Ethyl-p-toluenesulfonamide is a reagent used in the sulfonamidation of imidazopyridines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29350090 |
| Storage Class | 13 - Non Combustible Solids |





![(S)-4-Hydroxy-2-(3-methoxypropyl)-3,4-dihydro-2H-thieno[3,2-e][1,2]thiazine-6-sulfonamide 1,1-dioxide](https://img.chemicalbook.com/CAS/20180808/GIF/154127-42-1.gif)
