A6323912
4'-Nitroacetanilide , 98% , 104-04-1
Synonym(s):
4′-Nitroacetanilide;Acetic acid 4-nitroanilide;N-Acetyl-4-nitroaniline
CAS NO.:104-04-1
Empirical Formula: C8H8N2O3
Molecular Weight: 180.16
MDL number: MFCD00007303
EINECS: 203-169-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB103.20 | In Stock |
|
| 25G | RMB278.40 | In Stock |
|
| 100g | RMB1140.80 | In Stock |
|
| 500G | RMB5119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 213-215 °C(lit.) |
| Boiling point: | 312.97°C (rough estimate) |
| Density | 1.340 |
| refractive index | 1.6180 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | 2.2g/l |
| pka | 13.91±0.70(Predicted) |
| form | Solid |
| color | Yellow to green-yellow or green-brown |
| Water Solubility | 2.2g/L(room temperature) |
| Merck | 14,6581 |
| BRN | 2211962 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C8H8N2O3/c1-6(11)9-7-2-4-8(5-3-7)10(12)13/h2-5H,1H3,(H,9,11) |
| InChIKey | NQRLPDFELNCFHW-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference | 104-04-1(CAS DataBase Reference) |
| EPA Substance Registry System | Acetamide, N-(4-nitrophenyl)- (104-04-1) |
Description and Uses
4-Nitroacetanilide was used as a test substrate and its hydrolysis was determined by UV spectroscopic measurements. It was also used to prepare 4-aminoacetanilide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | AE5075000 |
| TSCA | TSCA listed |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | rat,LDLo,intraperitoneal,500mg/kg (500mg/kg),National Academy of Sciences, National Research Council, Chemical-Biological Coordination Center, Review. Vol. 5, Pg. 10, 1953. |







