A6324712
1-Nitropyrene , >98.0% , 5522-43-0
CAS NO.：5522-43-0
Empirical Formula: C16H9NO2
Molecular Weight: 247.25
MDL number: MFCD00004138
EINECS: 226-868-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB84.80 | In Stock |
|
| 5G | RMB234.40 | In Stock |
|
| 25G | RMB754.40 | In Stock |
|
| 100g | RMB2374.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-155 °C (lit.) |
| Boiling point: | 390.29°C (rough estimate) |
| Density | 1.1699 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly, Heated), Ethyl Acetate (Slightly, Heated) |
| form | powder |
| color | Yellow needles from MeCN |
| BRN | 1882811 |
| InChI | 1S/C16H9NO2/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H |
| InChIKey | ALRLPDGCPYIVHP-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc2ccc3cccc4ccc1c2c34 |
| CAS DataBase Reference | 5522-43-0(CAS DataBase Reference) |
| IARC | 2A (Vol. Sup 7, 46, 105) 2014 |
| NIST Chemistry Reference | 1-Nitropyrene(5522-43-0) |
| EPA Substance Registry System | 1-Nitropyrene (5522-43-0) |
Description and Uses
1-Nitropyrene (1-NP) is a nitro-polycyclic aromatic hydrocarbon (PAH) and a byproduct of incomplete combustion product from stationary combustion sources and in vehicle exhaust fumes.
1-Nitropyrene is the most abundant nitropolycylcic aromatic hydrocarbon found in exhaust from diesel engines with potent carcinogenic and mutagenic properties.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H351 |
| Precautionary statements | P281 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,Xi |
| Risk Statements | 40-20/21/22 |
| Safety Statements | 22-36/37/39-45-36/37 |
| WGK Germany | 3 |
| RTECS | UR2480000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29420000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 |
| Hazardous Substances Data | 5522-43-0(Hazardous Substances Data) |
| Toxicity | mic-sat 2500 ng/plate GDIKAN 29,278,1981 |
| Toxicity | mmo-esc 3 mg/plate MUREAV 142,163,85 |
