A6330012
4-<i>n</i>-Octyloxyphenol , >98.0%(GC) , 3780-50-5
CAS NO.：3780-50-5
Empirical Formula: C14H22O2
Molecular Weight: 222.32
MDL number: MFCD00045779
EINECS: 223-243-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB141.84 | In Stock |
|
| 5G | RMB495.20 | In Stock |
|
| 25G | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80°C |
| Boiling point: | 127 °C / 3mmHg |
| Density | 0.9906 (rough estimate) |
| refractive index | 1.4840 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 10.34±0.15(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C14H22O2/c1-2-3-4-5-6-7-12-16-14-10-8-13(15)9-11-14/h8-11,15H,2-7,12H2,1H3 |
| InChIKey | HFRUPPHPJRZOCM-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(OCCCCCCCC)C=C1 |
| CAS DataBase Reference | 3780-50-5(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 4-(octyloxy)- (3780-50-5) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 37/39-26-37 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HS Code | 29095000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
