A6330912
<i>N</i>-Ethyl-<small>D</small>-glucamine , >98.0%(T) , 14216-22-9
CAS NO.:14216-22-9
Empirical Formula: C8H19NO5
Molecular Weight: 209.24
MDL number: MFCD03789564
EINECS: 238-073-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB46.40 | In Stock |
|
| 100g | RMB141.60 | In Stock |
|
| 250G | RMB607.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-140 °C |
| alpha | -17 º (c=1%, H2O) |
| Boiling point: | 489.8±45.0 °C(Predicted) |
| Density | 1.320±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| pka | 13.51±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]/D 17.0±2.0°, c = 1% in H2O |
| Water Solubility | H2O: 0.1g/mL, clear to almost clear, colorless to very faintly yellow |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H19NO5/c1-2-9-3-5(11)7(13)8(14)6(12)4-10/h5-14H,2-4H2,1H3/t5-,6+,7+,8+/m0/s1 |
| InChIKey | IKXCHOUDIPZROZ-LXGUWJNJSA-N |
| SMILES | C(NCC)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
| CAS DataBase Reference | 14216-22-9(CAS DataBase Reference) |
Description and Uses
N-Ethyl-D-glucamine is an ethylated amino sugar derived from Glucose (G595000). It has low vapor pressure and good thermal stability in air, and is used in self-driven microfluidic method to pattern organic films directly in air.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Warning |
| Hazard statements | H290-H314-H332 |
| Precautionary statements | P264b-P271-P280-P284-P301+P330+P331-P304+P340-P305+P351+P338-P310-P363-P390-P402-P403+P233-P406b-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 3-10-23 |
| HS Code | 29221990 |
| Storage Class | 11 - Combustible Solids |





