A6333712
<i>N</i>-Carbobenzoxy-<small>D</small>-2-phenylglycine , >98.0%(HPLC) , 17609-52-8
Synonym(s):
Z-D -phenylglycine
CAS NO.：17609-52-8
Empirical Formula: C16H15NO4
Molecular Weight: 285.29
MDL number: MFCD00021703
EINECS: 241-582-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB65.60 | In Stock |
|
| 5G | RMB198.40 | In Stock |
|
| 25G | RMB515.20 | In Stock |
|
| 100g | RMB1625.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130.0 to 135.0 °C |
| Boiling point: | 495.3±45.0 °C(Predicted) |
| Density | 1.275±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethanol (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 3.49±0.10(Predicted) |
| color | Off-White |
| BRN | 2879381 |
| Major Application | peptide synthesis |
| InChI | 1S/C16H15NO4/c18-15(19)14(13-9-5-2-6-10-13)17-16(20)21-11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H,17,20)(H,18,19)/t14-/m1/s1 |
| InChIKey | RLDJWBVOZVJJOS-CQSZACIVSA-N |
| SMILES | OC(=O)[C@H](NC(=O)OCc1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 17609-52-8(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
