A6334312
Nonafluorovaleric Acid , >97.0% , 2706-90-3
Synonym(s):
Nonafluoropentanoic acid;Nonafluorovaleric acid;Perfluoropentanoic acid;PFPeA
CAS NO.:2706-90-3
Empirical Formula: C5HF9O2
Molecular Weight: 264.05
MDL number: MFCD00040211
EINECS: 220-300-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB95.20 | In Stock |
|
| 5G | RMB231.20 | In Stock |
|
| 25G | RMB895.20 | In Stock |
|
| 100g | RMB2511.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 140 °C(lit.) |
| Density | 1.713 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 140°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF: 10 mg/ml DMSO: 10 mg/ml Ethanol: 10 mg/mlPBS (pH 7.2): 1 mg/ml |
| pka | 0.40±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.713 |
| color | Clear light yellow to light brown |
| Water Solubility | Partly soluble in water. |
| BRN | 1800087 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C5HF9O2/c6-2(7,1(15)16)3(8,9)4(10,11)5(12,13)14/h(H,15,16) |
| InChIKey | CXZGQIAOTKWCDB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 2706-90-3(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorovaleric acid (2706-90-3) |
Description and Uses
Perfluoropentanoic acid is a short-chain perfluorocarboxylic acid (PFCA) generally used as an industrial surfactant and surface protector.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H318-H361d |
| Precautionary statements | P201-P202-P280-P305+P351+P338-P308+P313-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Dam. 1 Repr. 2 |





