A6335030
Bis(2,6-diisopropylphenyl)carbodiimide , Viscosity (50 ° C): 16-24MPAS , 2162-74-5
CAS NO.:2162-74-5
Empirical Formula: C25H34N2
Molecular Weight: 362.56
MDL number: MFCD00082211
EINECS: 218-487-5
| Pack Size | Price | Stock | Quantity |
| 250g | RMB447.20 | In Stock |
|
| 1kg | RMB1439.20 | In Stock |
|
| 5kg | RMB5199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51 °C |
| Boiling point: | 152-162 °C(Press: 0.05 Torr) |
| Density | 0.95±0.1 g/cm3(Predicted) |
| vapor pressure | 0.006Pa at 20℃ |
| Flash point: | 197℃ |
| storage temp. | 2-8°C |
| form | powder to lump |
| color | White to Almost white |
| Water Solubility | 50μg/L at 20℃ |
| InChI | InChI=1S/C25H34N2/c1-16(2)20-11-9-12-21(17(3)4)24(20)26-15-27-25-22(18(5)6)13-10-14-23(25)19(7)8/h9-14,16-19H,1-8H3 |
| InChIKey | XLDBGFGREOMWSL-UHFFFAOYSA-N |
| SMILES | N(C1C(=CC=CC=1C(C)C)C(C)C)=C=NC1C(=CC=CC=1C(C)C)C(C)C |
| LogP | 6.2 at 30℃ |
| CAS DataBase Reference | 2162-74-5 |
| EPA Substance Registry System | Benzenamine, N,N'-methanetetraylbis[2,6-bis(1-methylethyl)- (2162-74-5) |
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310+P330-P405-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-24/25 |
| RIDADR | 2811 |
| RTECS | CY0887250 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29213000 |
| Toxicity | LD50 orl-rat: 200 mg/kg NTIS** OTS0545280 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




