A6335530
7-Bromoindole-2-carboxylic acid , ≥95.0% , 16732-71-1
Synonym(s):
7-Bromo-1H-indole-2-carboxylic acid
CAS NO.：16732-71-1
Empirical Formula: C9H6BrNO2
Molecular Weight: 240.05
MDL number: MFCD00744954
EINECS: 201-215-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB414.40 | In Stock |
|
| 5g | RMB1324.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 238-243°C |
| Boiling point: | 470.9±25.0 °C(Predicted) |
| Density | 1.838±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | 4.22±0.30(Predicted) |
| Appearance | White to light yellow Solid |
| InChI | 1S/C9H6BrNO2/c10-6-3-1-2-5-4-7(9(12)13)11-8(5)6/h1-4,11H,(H,12,13) |
| InChIKey | ZKGMXVLKFBRKNN-UHFFFAOYSA-N |
| SMILES | OC(C1=CC2=C(N1)C(Br)=CC=C2)=O |
Description and Uses
7-Bromoindole-2-carboxylic acid is an organic compound that is often used as a synthetic intermediate for drugs, dyes, and other chemical products.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
