A6335630
4-Bromo-2-fluorophenylacetic acid , 98% , 114897-92-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5g | RMB104.00 | In Stock |
|
| 25g | RMB350.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-126° |
| Boiling point: | 320.4±27.0 °C(Predicted) |
| Density | 1.697±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.89±0.10(Predicted) |
| form | Solid |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C8H6BrFO2/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4H,3H2,(H,11,12) |
| InChIKey | PNBIYFPZODYMOO-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(Br)C=C1F |
Description and Uses
4-Bromo-2-fluorophenylacetic acid is a carboxylic acid organic compound, which can be used as a pharmaceutical intermediate for pharmaceutical synthesis and scientific research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| HS Code | 2916399090 |
