A6335930
Boc-β-(3-benzothienyl)-Ala-OH , ≥96% , 154902-51-9
Synonym(s):
Boc-3-(3-benzothienyl)-L -alanine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB211.20 | In Stock |
|
| 5g | RMB888.00 | In Stock |
|
| 25g | RMB4258.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 514.1±45.0 °C(Predicted) |
| Density | 1.274±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| pka | 3.85±0.10(Predicted) |
| Appearance | White to off-white Solid |
| BRN | 7081201 |
| Major Application | peptide synthesis |
| InChI | 1S/C16H19NO4S/c1-16(2,3)21-15(20)17-12(14(18)19)8-10-9-22-13-7-5-4-6-11(10)13/h4-7,9,12H,8H2,1-3H3,(H,17,20)(H,18,19)/t12-/m0/s1 |
| InChIKey | MURVSBJYXHTRJQ-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1csc2ccccc12)C(O)=O |
| CAS DataBase Reference | 154902-51-9(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H318 |
| Precautionary statements | P264b-P270-P280-P305+P351+P338-P310-P330-P403-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| F | 10-23 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |







![(S)-2-Amino-3-(benzo[b]thiophen-3-yl)propanoic acid](https://img.chemicalbook.com/CAS/GIF/72120-71-9.gif)
