A6343312
<i>N</i>-Succinimidyl 3-Maleimidobenzoate [Cross-linking Reagent] , >98.0%(HPLC) , 58626-38-3
Synonym(s):
MBS
CAS NO.:58626-38-3
Empirical Formula: C15H10N2O6
Molecular Weight: 314.25
MDL number: MFCD00005514
EINECS: 261-368-8
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB225.60 | In Stock |
|
| 500MG | RMB469.60 | In Stock |
|
| 1G | RMB911.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-177 °C(lit.) |
| Boiling point: | 524.5±52.0 °C(Predicted) |
| Density | 1.59±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | ethyl acetate or DMF: ≤20 mg/mL may require addition of solvent to coupling buffer to at least 5% to maintain solubility |
| form | crystalline |
| pka | -2.63±0.20(Predicted) |
| color | White to Almost white |
| Sensitive | Moisture & Light Sensitive |
| BRN | 1505254 |
| InChI | 1S/C15H10N2O6/c18-11-4-5-12(19)16(11)10-3-1-2-9(8-10)15(22)23-17-13(20)6-7-14(17)21/h1-5,8H,6-7H2 |
| InChIKey | LLXVXPPXELIDGQ-UHFFFAOYSA-N |
| SMILES | O=C1CCC(N1OC(C2=CC=CC(N3C(C=CC3=O)=O)=C2)=O)=O |
| CAS DataBase Reference | 58626-38-3(CAS DataBase Reference) |
Description and Uses
MBS is a heterobifunction crosslinker that contains a maleimide group which is reactive towards sulfhydryls and an NHS ester, useful for targeting amine groups.
3-Maleimidobenzoic acid N-hydroxysuccinimide ester is a heterobifunctional coupling reagent useful for forming enzyme immunoconjugates. The reactive groups are the NHS ester and maeimide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |

![<i>N</i>-Succinimidyl 3-Maleimidobenzoate [Cross-linking Reagent]](https://img.chemicalbook.com/CAS/GIF/58626-38-3.gif)



