A6343412
<i>N</i>-Succinimidyl 4-Maleimidobutyrate [Cross-linking Reagent] , >98.0%(HPLC) , 80307-12-6
Synonym(s):
N-(γ-Maleimidobutyryloxy)succinimide;N-Succinimidyl 4-maleimidobutyrate;4-Maleimidobutyric acid N-succinimidyl ester;GMBS;N-γ-Maleimidobutyryloxysuccinimide
CAS NO.:80307-12-6
Empirical Formula: C12H12N2O6
Molecular Weight: 280.23
MDL number: MFCD00036817
EINECS: 625-693-2
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB84.80 | In Stock |
|
| 250mg | RMB160.80 | In Stock |
|
| 100MG | RMB232.00 | In Stock |
|
| 1G | RMB516.80 | In Stock |
|
| 5g | RMB2612.00 | In Stock |
|
| 25g | RMB12670.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-129 °C |
| Boiling point: | 461.3±47.0 °C(Predicted) |
| Density | 1.49±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | chloroform: 100 mg/mL |
| form | powder |
| pka | -2.27±0.20(Predicted) |
| color | White to Pale Yellow |
| BRN | 6427689 |
| Stability: | Hygroscopic, Moisture Sensitive |
| InChI | InChI=1S/C12H12N2O6/c15-8-3-4-9(16)13(8)7-1-2-12(19)20-14-10(17)5-6-11(14)18/h3-4H,1-2,5-7H2 |
| InChIKey | PVGATNRYUYNBHO-UHFFFAOYSA-N |
| SMILES | N1(CCCC(ON2C(=O)CCC2=O)=O)C(=O)C=CC1=O |
Description and Uses
A short, sulfhydryl and amino reactive heterobifunctional crosslinking reagent. Introduces maleimide groups into IgM
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |

![<i>N</i>-Succinimidyl 4-Maleimidobutyrate [Cross-linking Reagent]](https://img.chemicalbook.com/CAS/GIF/80307-12-6.gif)





