A6347112
1-(2-Nitrophenyl)piperazine , >98.0%(GC) , 59084-06-9
CAS NO.:59084-06-9
Empirical Formula: C10H13N3O2
Molecular Weight: 207.23
MDL number: MFCD00040728
EINECS: 261-593-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB82.40 | In Stock |
|
| 5G | RMB285.60 | In Stock |
|
| 25G | RMB888.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 142-144°C 1mm |
| Density | 1.222±0.06 g/cm3(Predicted) |
| refractive index | 1.6080 to 1.6120 |
| storage temp. | 2-8°C, protect from light |
| form | clear liquid |
| pka | 8.73±0.10(Predicted) |
| color | Orange to Red |
| InChI | 1S/C10H13N3O2/c14-13(15)10-4-2-1-3-9(10)12-7-5-11-6-8-12/h1-4,11H,5-8H2 |
| InChIKey | YJRCDSXLKPERNV-UHFFFAOYSA-N |
| SMILES | [N+](=O)([O-])c1c(cccc1)N2CCNCC2 |
| CAS DataBase Reference | 59084-06-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-36/37/39 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT-HARMFUL |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |







