A6349330
N-Fmoc-D-aspartic acid 1-tert-butyl ester , 95% , 134098-70-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB60.80 | In Stock |
|
| 5g | RMB250.40 | In Stock |
|
| 10g | RMB447.20 | In Stock |
|
| 25g | RMB1034.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-98°C |
| Boiling point: | 617.4±55.0 °C(Predicted) |
| Density | 1.251±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in DMF. |
| pka | 4.08±0.19(Predicted) |
| form | Solid |
| color | White to off-white |
| Major Application | peptide synthesis |
| InChI | 1S/C23H25NO6/c1-23(2,3)30-21(27)19(12-20(25)26)24-22(28)29-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,12-13H2,1-3H3,(H,24,28)(H,25,26)/t19-/m1/s1 |
| InChIKey | VZXQYACYLGRQJU-LJQANCHMSA-N |
| SMILES | N([C@H](CC(=O)O)C(=O)OC(C)(C)C)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
Description and Uses
N-Fmoc-D-aspartic acid 1-tert-butyl ester is an pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 2 |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
