A6355812
5-Norbornene-2,3-dicarboxylic Acid , >98.0% , 3813-52-3
CAS NO.：3813-52-3
Empirical Formula: C9H10O4
Molecular Weight: 182.17
MDL number: MFCD00003735
EINECS: 223-301-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB20.00 | In Stock |
|
| 5G | RMB28.00 | In Stock |
|
| 25G | RMB95.20 | In Stock |
|
| 100g | RMB339.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175 °C (dec.)(lit.) |
| Boiling point: | 275.56°C (rough estimate) |
| Density | 1.2481 (rough estimate) |
| refractive index | 1.4345 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.91±0.40(Predicted) |
| form | solid |
| color | White |
| InChI | 1S/C9H10O4/c10-8(11)6-4-1-2-5(3-4)7(6)9(12)13/h1-2,4-7H,3H2,(H,10,11)(H,12,13)/t4-,5+,6-,7+ |
| InChIKey | NIDNOXCRFUCAKQ-UMRXKNAASA-N |
| SMILES | OC(=O)[C@@H]1[C@H]2C[C@H](C=C2)[C@@H]1C(O)=O |
Description and Uses
5-Norbornene-2,3-dicarboxylic acid is used to prepare cyclic olefin copolymers and is also an important raw material for the synthesis of the antidepressant drug lurasidone.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2917399590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
