A6357012
3-Nitrobenzyl Chloride , >98.0% , 619-23-8
Synonym(s):
α-Chloro-3-nitrotoluene
CAS NO.:619-23-8
Empirical Formula: C7H6ClNO2
Molecular Weight: 171.58
MDL number: MFCD00007272
EINECS: 210-586-1
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-47 °C(lit.) |
| Boiling point: | 85-87 °C5 mm Hg(lit.) |
| Density | 1503 |
| refractive index | 1.5577 (estimate) |
| Flash point: | >230 °F |
| solubility | soluble in Methanol |
| form | Crystalline Solid |
| color | Light yellow to light brown |
| Water Solubility | <0.1 g/100 mL at 22 ºC |
| BRN | 742794 |
| InChI | 1S/C7H6ClNO2/c8-5-6-2-1-3-7(4-6)9(10)11/h1-4H,5H2 |
| InChIKey | APGGSERFJKEWFG-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cccc(CCl)c1 |
| CAS DataBase Reference | 619-23-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-(chloromethyl)-3-nitro-(619-23-8) |
| EPA Substance Registry System | 3-Nitrobenzyl chloride (619-23-8) |
Description and Uses
3-Nitrobenzyl chloride was used in the synthesis of 8-chloropurine.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-36 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | XS9090000 |
| F | 4.8-10-19-21 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Hazardous Substances Data | 619-23-8(Hazardous Substances Data) |



