A6365512
4-<WBR>(4-<WBR>NITROPHENYL)<WBR>MORPHOLINE , 98% , 10389-51-2
CAS NO.:10389-51-2
Empirical Formula: C10H12N2O3
Molecular Weight: 208.21
MDL number: MFCD00023317
EINECS: 233-851-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5g | RMB68.40 | In Stock |
|
| 25g | RMB281.60 | In Stock |
|
| 100G | RMB1351.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152 °C |
| Boiling point: | 386.2±37.0 °C(Predicted) |
| Density | 1.265±0.06 g/cm3(Predicted) |
| RTECS | QE7405000 |
| storage temp. | Storage temp. 2-8°C |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 0.81±0.40(Predicted) |
| color | Light yellow to Yellow to Orange |
| λmax | 375nm(Dioxane)(lit.) |
| InChI | InChI=1S/C10H12N2O3/c13-12(14)10-3-1-9(2-4-10)11-5-7-15-8-6-11/h1-4H,5-8H2 |
| InChIKey | IAJDSUYFELYZCS-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=C([N+]([O-])=O)C=C2)CCOCC1 |
| CAS DataBase Reference | 10389-51-2(CAS DataBase Reference) |
| EPA Substance Registry System | Morpholine, 4-(4-nitrophenyl)- (10389-51-2) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 40-42/43-63 |
| Safety Statements | 26-36 |
| RIDADR | 1662 |
| TSCA | TSCA listed |
| HS Code | 2934999090 |







