A6374712
2-<WBR>Nitrophloroglucinol , 95% , 16600-92-3
CAS NO.：16600-92-3
Empirical Formula: C6H5NO5
Molecular Weight: 171.11
MDL number: MFCD00016996
EINECS: 240-656-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB141.60 | In Stock |
|
| 1G | RMB271.20 | In Stock |
|
| 5g | RMB940.00 | In Stock |
|
| 25g | RMB4612.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189-193 °C (lit.) |
| Boiling point: | 343.0±22.0 °C(Predicted) |
| Density | 1.771±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 4.92±0.20(Predicted) |
| form | Solid |
| color | Red |
| BRN | 1963331 |
| InChI | 1S/C6H5NO5/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,8-10H |
| InChIKey | QSVQZFVXAUGEMT-UHFFFAOYSA-N |
| SMILES | Oc1cc(O)c(c(O)c1)[N+]([O-])=O |
| CAS DataBase Reference | 16600-92-3(CAS DataBase Reference) |
Description and Uses
2-Nitrophloroglucinol is a useful synthetic intermediate. It is used to prepare benzoxazoles and benzothiazoles as selective ligands for human β-estrogen receptor (ER-β).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 29089990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
