PRODUCT Properties
| Melting point: | 92-94 °C |
| Boiling point: | 368.92°C (rough estimate) |
| Density | 1.2422 (rough estimate) |
| refractive index | 1.5880 (estimate) |
| InChI | 1S/C13H9NO3/c15-13(10-5-2-1-3-6-10)11-7-4-8-12(9-11)14(16)17/h1-9H |
| InChIKey | MFYLRNKOXORIPK-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cccc(c1)C(=O)c2ccccc2 |
| CAS DataBase Reference | 2243-80-3(CAS DataBase Reference) |
Description and Uses
3-Nitrobenzophenone was used as starting reagent in the synthesis of ketoprofen, non-steroidal anti inflammatory drug. It was also used as plastic additive and its role in photolytic degradation of polyethylene and polypropylene in solution has been investigated.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2914790090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
