A6387912
4-<WBR>Nitro-<WBR>1,8-<WBR>naphthalic anhydride , 95% , 6642-29-1
CAS NO.:6642-29-1
Empirical Formula: C12H5NO5
Molecular Weight: 243.17
MDL number: MFCD00013446
EINECS: 229-659-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB119.20 | In Stock |
|
| 1g | RMB303.20 | In Stock |
|
| 5G | RMB1068.00 | In Stock |
|
| 25G | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 226-229 °C (lit.) |
| Boiling point: | 509.9±33.0 °C(Predicted) |
| Density | 1.637±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| color | Dark yellow |
| BRN | 237909 |
| InChI | 1S/C12H5NO5/c14-11-7-3-1-2-6-9(13(16)17)5-4-8(10(6)7)12(15)18-11/h1-5H |
| InChIKey | LKOZHLXUWUBRDK-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc2C(=O)OC(=O)c3cccc1c23 |
Description and Uses
4-Nitro-1,8-naphthalic anhydride can be used:
- As a precursor to synthesize N-phenyl-amino-1,8-naphthalimide based fluorescent chemosensor to detect nitro-antibiotics at ppb level.
- As a building block to synthesize shape memory polymers due to its ability to undergo Diels-Alder reaction
- As a fluorochrome substrate for nitrogen reductase for noninvasive hypoxia imaging in cancer detection.
- As a precursor to synthesize amphiphilic naphthalimide dyes with good color brilliancy.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2932990090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |


