A6406412
N-(2-Aminoethyl)biotinamide , 98% , 111790-37-5
Synonym(s):
N-(2-Aminoethyl)biotinamide trifluoroacetate salt
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB119.20 | In Stock |
|
| 250MG | RMB391.20 | In Stock |
|
| 1g | RMB1039.20 | In Stock |
|
| 5G | RMB3759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-174°C |
| Boiling point: | 643.7±50.0 °C(Predicted) |
| Density | 1.189±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| form | solid |
| pka | 13.90±0.40(Predicted) |
| color | Pale yellow |
| InChI | InChI=1S/C12H22N4O2S/c13-5-6-14-10(17)4-2-1-3-9-11-8(7-19-9)15-12(18)16-11/h8-9,11H,1-7,13H2,(H,14,17)(H2,15,16,18)/t8-,9-,11-/m0/s1 |
| InChIKey | BNCJEZWKLUBUBB-QXEWZRGKSA-N |
| SMILES | C1(=O)N[C@]2([H])[C@H](CCCCC(NCCN)=O)SC[C@]2([H])N1 |
Description and Uses
Biotin-EDA is a biotinylated compound that enables simple biotinylation of antibodies, proteins and any other carboxyl-containing biomolecules. The primary amine group of this reagent can react with moieties such as -NHS, -COOH to form stable, irreversible amide bonds.
N-(2-Aminoethyl)biotinamide Hydrochloride is a derivative of Biotin (B389040) which is a growth factor present in minute amounts in every living cell.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P280-P302+P352-P271 |
| HS Code | 2933998090 |
