A6451012
N-Methyl-L-leucine HCl , 98% , 66866-69-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB600.00 | In Stock |
|
| 5G | RMB1439.20 | In Stock |
|
| 25G | RMB5480.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-163 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Solid |
| color | White to off-white |
| BRN | 6095746 |
| Major Application | peptide synthesis |
| InChI | 1S/C7H15NO2.ClH/c1-5(2)4-6(8-3)7(9)10;/h5-6,8H,4H2,1-3H3,(H,9,10);1H/t6-;/m0./s1 |
| InChIKey | QYFWCUVWMMTENJ-RGMNGODLSA-N |
| SMILES | Cl.CN[C@@H](CC(C)C)C(O)=O |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 2915601990 |
| Storage Class | 11 - Combustible Solids |







