A6465812
3-N-Boc-aminocyclohexanone , 97% , 885280-38-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.00 | In Stock |
|
| 1G | RMB75.20 | In Stock |
|
| 5G | RMB232.00 | In Stock |
|
| 25g | RMB1033.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-85oC |
| Boiling point: | 335.9±31.0 °C(Predicted) |
| Density | 1.06±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 12.01±0.20(Predicted) |
| form | Solid |
| color | Pale Beige |
| InChI | InChI=1S/C11H19NO3/c1-11(2,3)15-10(14)12-8-5-4-6-9(13)7-8/h8H,4-7H2,1-3H3,(H,12,14) |
| InChIKey | VGDCXKATFLOEHF-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NC1CCCC(=O)C1 |
| CAS DataBase Reference | 885280-38-6 |
Description and Uses
(3-Oxocyclohexyl)carbamic Acid tert-Butyl Ester is used to prepare (benzyloxy)benzamides as TRPM8 antagonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2922390090 |



![tert-Butylpyrazolo[1,5-a]pyrimidin-3-ylcarbamate](https://img.chemicalbook.com/CAS/20150408/GIF/1394003-66-7.gif)



