A6520712
2′,3′-O-Isopropylideneadenosine , 98% , 362-75-4
CAS NO.：362-75-4
Empirical Formula: C13H17N5O4
Molecular Weight: 307.31
MDL number: MFCD00005756
EINECS: 206-650-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB52.80 | In Stock |
|
| 25G | RMB128.80 | In Stock |
|
| 100G | RMB513.60 | In Stock |
|
| 500g | RMB2319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 221-222 °C(lit.) |
| Boiling point: | 447.81°C (rough estimate) |
| Density | 1.2370 (rough estimate) |
| refractive index | -105 ° (C=1, Dioxane) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Dioxane (Slightly, Sonicated), DMSO (Slightly), Methanol (Slightly) |
| pka | 14.14±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| optical activity | [α]20/D 98.5°, c = 1 in dioxane |
| BRN | 43435 |
| InChI | InChI=1S/C13H17N5O4/c1-13(2)21-8-6(3-19)20-12(9(8)22-13)18-5-17-7-10(14)15-4-16-11(7)18/h4-6,8-9,12,19H,3H2,1-2H3,(H2,14,15,16)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | LCCLUOXEZAHUNS-WOUKDFQISA-N |
| SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)[C@@H]2OC(O[C@H]12)(C)C |
| CAS DataBase Reference | 362-75-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Adenosine, 2',3'-o-isopropylidene(362-75-4) |
Description and Uses
2',3'-O-Isopropylideneadenosine is used as an organic chemical synthesis intermediate.
