A6522612
Oxcarbazepine , 98% , 28721-07-5
Synonym(s):
10,11-Dihydro-10-oxo-5h-dibenz[b,f]azepine-5-carboxamide;Oxacarbazepine;Oxcarbazepine
CAS NO.:28721-07-5
Empirical Formula: C15H12N2O2
Molecular Weight: 252.27
MDL number: MFCD00865307
EINECS: 249-188-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB86.40 | In Stock |
|
| 25G | RMB236.00 | In Stock |
|
| 100G | RMB828.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 215-216°C |
| Boiling point: | 457.2±55.0 °C(Predicted) |
| Density | 1.329±0.06 g/cm3(Predicted) |
| Flash point: | 230.3±31.5 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: ~9 mg/mL |
| form | solid |
| pka | 13.73±0.20(Predicted) |
| color | white |
| Water Solubility | Soluble in DMSO, methanol, water, ethanol and acetone. |
| Merck | 14,6929 |
| BCS Class | 4 |
| InChI | InChI=1S/C15H12N2O2/c16-15(19)17-12-7-3-1-5-10(12)9-14(18)11-6-2-4-8-13(11)17/h1-8H,9H2,(H2,16,19) |
| InChIKey | CTRLABGOLIVAIY-UHFFFAOYSA-N |
| SMILES | N1(C(N)=O)C2=CC=CC=C2C(=O)CC2=CC=CC=C12 |
| CAS DataBase Reference | 28721-07-5(CAS DataBase Reference) |
| EPA Substance Registry System | 5H-Dibenz[b,f]azepine-5-carboxamide, 10,11-dihydro-10-oxo- (28721-07-5) |
Description and Uses
Oxcarbazepine is a new antiepileptic carbamazepine derivative, reportedly better tolerated than carbamazepine. It appears to be most effective in partial epilepsy with complex seizures.
beta-adrenergic blocker
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,F |
| Risk Statements | 22-36-20/21/22-11 |
| Safety Statements | 16-36/37 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 3 |
| RTECS | HN8445000 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 28721-07-5(Hazardous Substances Data) |




