A6523912
L-Orn(Z)-OH , 98% , 3304-51-6
CAS NO.:3304-51-6
Empirical Formula: C13H18N2O4
Molecular Weight: 266.29
MDL number: MFCD00037220
EINECS: 221-980-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB164.00 | In Stock |
|
| 100g | RMB455.20 | In Stock |
|
| 500g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 248-252℃ |
| Boiling point: | 492.2±45.0 °C(Predicted) |
| Density | 1.234±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Acidic Alcohol (Sparingly), Aqueous Acid (Slightly) |
| pka | 2.51±0.24(Predicted) |
| form | Solid |
| color | White |
| InChI | 1S/C13H18N2O4/c14-8-4-7-11(12(16)17)15-13(18)19-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9,14H2,(H,15,18)(H,16,17)/t11-/m0/s1 |
| InChIKey | ZYGRWJVRLNJIMR-NSHDSACASA-N |
| SMILES | NCCC[C@H](NC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 3304-51-6(CAS DataBase Reference) |
Description and Uses
L-Orn(Z)-OH is used as a reactant in the synthesis of cyclic aminohexapeptides which showed antifungal activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |







