A6524012
(S)-(+)-2,3-Diaminopropionic Acid Hydrochloride , 97% , 1482-97-9
CAS NO.:1482-97-9
Empirical Formula: C3H9ClN2O2
Molecular Weight: 140.57
MDL number: MFCD00065497
EINECS: 625-088-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB87.20 | In Stock |
|
| 25g | RMB399.20 | In Stock |
|
| 100g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 231-233 °C (dec.) |
| alpha | 24 º (c=2, 0.5 M HCl) |
| refractive index | 24 ° (C=2, 1mol/L HCl) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Aqueous Acid (Slightly), Water (Slightly) |
| form | powder |
| color | Off-white |
| Sensitive | Hygroscopic |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C3H8N2O2.ClH/c4-1-2(5)3(6)7;/h2H,1,4-5H2,(H,6,7);1H/t2-;/m0./s1 |
| InChIKey | SKWCZPYWFRTSDD-DKWTVANSSA-N |
| SMILES | [C@H](N)(CN)C(=O)O.Cl |
| CAS DataBase Reference | 1482-97-9(CAS DataBase Reference) |
Description and Uses
(2S)-2,3-Diaminopropanoic Acid Hydrochloride is a non-proteinogenic amino acid that can be used in the synthesis of peptides containing non-proteinogenic amino acids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29224999 |




