A6526212
Oxytetracycline dihydrate , 97% , 6153-64-6
CAS NO.:6153-64-6
Empirical Formula: C22H28N2O11
Molecular Weight: 496.46
MDL number: MFCD00151234
EINECS: 612-168-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.80 | In Stock |
|
| 5G | RMB135.20 | In Stock |
|
| 25G | RMB361.60 | In Stock |
|
| 100G | RMB1114.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-182 °C |
| alpha | -216 º (c=1,0.1 M HCl) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 1 M HCl: 0.1 M yellow to yellow-orange, clear |
| form | crystalline |
| color | yellow |
| Water Solubility | slightly soluble |
| InChIKey | IBZHEBHGZFICKS-IFLJXUKPSA-N |
| SMILES | O.[H][C@@]12[C@@H](O)[C@@]3([H])C(C(=O)c4c(O)cccc4[C@@]3(C)O)=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@H]2N(C)C |
| CAS DataBase Reference | 6153-64-6(CAS DataBase Reference) |
| EPA Substance Registry System | Oxytetracycline dihydrate (6153-64-6) |
Description and Uses
antihypertensive
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H361d-H411 |
| Precautionary statements | P201-P202-P273-P280-P308+P313-P391 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 63-36-36/37/38 |
| Safety Statements | 22-24/25-36/37/39-26-36 |
| WGK Germany | 3 |
| HS Code | 29413000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 Repr. 2 |






