Oleic acid , Analysis of standard products, ≥99.0%(GC) , 112-80-1
Synonym(s):
Oleic acid;OlAc;cis-9-Octadecenoic acid;cis-9-Octadecenoic Acid, 18:1;Elainic acid
CAS NO.:112-80-1
Empirical Formula: C18H34O2
Molecular Weight: 282.46
MDL number: MFCD00064242
EINECS: 204-007-1
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB158.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 13-14 °C(lit.) |
| Boiling point: | 360 °C |
| Density | 0.89 g/mL at 25 °C(lit.) |
| vapor density | 1.03 (vs air) |
| vapor pressure | 52 mm Hg ( 37 °C) |
| FEMA | 2815 | OLEIC ACID |
| refractive index | n |
| Flash point: | 133 °F |
| storage temp. | -20°C |
| solubility | Miscible with ethanol, ether, acetone, chloroform, dimethyl formamide and dimethyl sulfoxide. |
| form | Liquid |
| pka | pKa 5.35(H2O,t =25) (Uncertain) |
| Specific Gravity | 0.892 (20/4℃) |
| color | Colorless to pale yellow |
| Odor | Peculiar Lard-Like |
| Odor Type | fatty |
| biological source | plant (Sunflower) |
| Water Solubility | negligible |
| Sensitive | Air Sensitive |
| Merck | 14,6828 |
| JECFA Number | 333 |
| BRN | 1726542 |
| Hydrophilic-Lipophilic Balance (HLB) | 1 |
| Dielectric constant | 2.5(20℃) |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, aluminium. |
| Major Application | microbiology |
| Cosmetics Ingredients Functions | SURFACTANT - EMULSIFYING SKIN CONDITIONING - EMOLLIENT |
| Cosmetic Ingredient Review (CIR) | Oleic acid (112-80-1) |
| InChI | 1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- |
| InChIKey | ZQPPMHVWECSIRJ-KTKRTIGZSA-N |
| SMILES | CCCCCCCC\C=C/CCCCCCCC(O)=O |
| LogP | 7.698 (est) |
| CAS DataBase Reference | 112-80-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 9-Octadecenoic acid (Z)-(112-80-1) |
| EPA Substance Registry System | Oleic acid (112-80-1) |
Description and Uses
Oleic acid is a monounsaturated fatty acid and a major component of membrane phospholipids that has been found in human plasma, cell membranes, and adipose tissue. It contributes approximately 17% of the total fatty acids esterified to phosphatidylcholine, the major phospholipid class in porcine platelets. Oleic acid inhibits collagen-stimulated platelet aggregation by approximately 90% when used at a concentration of 10 μg/ml. It also inhibits fMLF-induced neutrophil aggregation and degranulation by 55 and 68%, respectively, when used at a concentration of 5 μM, similar to arachidonic acid ( | 90010.1 | 10006607). Oleic acid (60 μM) induces release of intracellular calcium in human platelets. In vivo, oleic acid increases TNF-α, IL-8, IL-6, and IL-1β production, neutrophil accumulation, and apoptotic and necrotic cell death in mouse lung and has been used to induce lung injury in a mouse model of acute respiratory distress syndrome (ARDS).
Oleic Acid is an unsaturated fatty acid that functions as a lubricant, binder, and defoamer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H320-H319-H315 |
| Precautionary statements | P280a-P305+P351+P338-P321-P332+P313-P337+P313-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,Xi |
| Risk Statements | 23/24/25-34-40-43-36/37/38-38 |
| Safety Statements | 36/37-37/39-26-36-36/37/39 |
| RIDADR | UN 1198 3/PG 3 |
| WGK Germany | 2 |
| RTECS | LP8925000 |
| F | 10 |
| Autoignition Temperature | 363°C |
| TSCA | TSCA listed |
| HS Code | 29161500 |
| Storage Class | 10 - Combustible liquids |
| Hazardous Substances Data | 112-80-1(Hazardous Substances Data) |
| Toxicity | LD50 i.v. in mice: 230±18 mg/kg (Or, Wretlind) |



