A6532412
Oxalic acid dihydrate , ACS,≥99% , 6153-56-6
Synonym(s):
Ethanedioic acid;Ethanedioic acid dihydrate;Ethanedioic Acid, Dihydrate, Ethanedioic Acid;Oxalic acid dihydrate;Oxalic Acid, Dihydrate
CAS NO.:6153-56-6
Empirical Formula: C2H6O6
Molecular Weight: 126.07
MDL number: MFCD00149102
EINECS: 612-167-2
| Pack Size | Price | Stock | Quantity |
| 500G | RMB94.40 | In Stock |
|
| 2.5KG | RMB318.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-106 °C(lit.) |
| Boiling point: | 108-109°C |
| bulk density | 813kg/m3 |
| Density | 1,65 g/cm3 |
| vapor density | 4.4 (vs air) |
| vapor pressure | <0.01 mm Hg ( 20 °C) |
| Flash point: | 157°C |
| storage temp. | Store at +5°C to +30°C. |
| solubility | H2O: soluble1M at 20°C, clear, colorless |
| form | Powder/Solid |
| color | Yellow to yellow-green |
| Specific Gravity | 1.65 |
| PH | ~1.0 (25℃, 1M in H2O) |
| PH Range | 6 - 8 at 25 °C |
| Water Solubility | 138 g/L (20 ºC) |
| Sublimation | 157 ºC |
| Merck | 14,6911 |
| BRN | 3679436 |
| Exposure limits | TLV-TWA for anhydrous acid 1 mg/m3
(ACGIH, MSHA, and OSHA); TLV-STEL
2 mg/m3 (ACGIH). |
| Stability: | Stable. Incompatible with bases, acid chlorides, steel, silver, silver compounds, moisture. Avoid contact with metals. |
| InChI | 1S/C2H2O4.2H2O/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);2*1H2 |
| InChIKey | GEVPUGOOGXGPIO-UHFFFAOYSA-N |
| SMILES | [H]O[H].[H]O[H].OC(=O)C(O)=O |
| CAS DataBase Reference | 6153-56-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Oxalic acid dihydrate(6153-56-6) |
| EPA Substance Registry System | Oxalic acid dihydrate (6153-56-6) |
| Absorption | cut-off at 303nm in H2O at 1M |
Description and Uses
Oxalic acid dihydrate is a purifying agent in pharmaceutical industry, special in antibiotic medication, such as Oxytetracycline , Chloramphenicol , etc; * Precipitating agent in Rare-earth mineral processing; * Bleaching agent in the textile activities, wood pulp bleaching; * Rust-remover for Metal treatment; * Grinding agent, such as Marble polishing; * Waste water treatment, removing calcium from water.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312-H318 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,C |
| Risk Statements | 21/22-41 |
| Safety Statements | 24/25-39-37-36-26 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 1 |
| RTECS | RO2450000 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29171100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Eye Dam. 1 |
| Toxicity | LD50 orally in Rabbit: 375 mg/kg |





