A6534212
Olaquindox , Analysis standard , 23696-28-8
CAS NO.：23696-28-8
Empirical Formula: C12H13N3O4
Molecular Weight: 263.25
MDL number: MFCD00210341
EINECS: 245-832-7
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 209°C (dec.) |
| Boiling point: | 406.49°C (rough estimate) |
| Density | 1.2755 (rough estimate) |
| refractive index | 1.5290 (estimate) |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly) |
| form | Solid |
| pka | 13.75±0.10(Predicted) |
| color | Yellow |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C12H13N3O4/c1-8-11(12(17)13-6-7-16)15(19)10-5-3-2-4-9(10)14(8)18/h2-5,16H,6-7H2,1H3,(H,13,17) |
| InChIKey | TURHTASYUMWZCC-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)NCCO)[n+]([O-])c2ccccc2[n+]1[O-] |
| CAS DataBase Reference | 23696-28-8(CAS DataBase Reference) |
Description and Uses
Olaquindox is an antibacterial derivative of quinoxaline, used as a growth promoter for pigs.
Olaquindox is a growth promotor in pig-breeding; acts as a chemotherapeutic agent prophylactically used to lower the frequency of bacterial enteritis in pigs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-43-42 |
| Safety Statements | 36/37-22 |
| WGK Germany | WGK 3 |
| RTECS | VD1582000 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Resp. Sens. 1 |
| Hazardous Substances Data | 23696-28-8(Hazardous Substances Data) |
