A6552212
5-Acetylvaleric acid , 96% , 3128-07-2
CAS NO.:3128-07-2
Empirical Formula: C7H12O3
Molecular Weight: 144.17
MDL number: MFCD00051479
EINECS: 221-512-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB59.20 | In Stock |
|
| 5G | RMB215.20 | In Stock |
|
| 25G | RMB812.00 | In Stock |
|
| 100G | RMB3039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 35-37 °C (lit.) |
| Boiling point: | 158-162 °C/9 mmHg (lit.) |
| Density | 1.059 g/mL at 25 °C (lit.) |
| refractive index | 1.449 |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 4.69±0.10(Predicted) |
| form | crystalline solid |
| color | White |
| Water Solubility | Soluble in water |
| Sensitive | Hygroscopic |
| BRN | 1362931 |
| InChI | InChI=1S/C7H12O3/c1-6(8)4-2-3-5-7(9)10/h2-5H2,1H3,(H,9,10) |
| InChIKey | IZOQMUVIDMLRDC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCC(=O)C |
| CAS DataBase Reference | 3128-07-2(CAS DataBase Reference) |
Description and Uses
5-Acetylvaleric acid, is used as a reagent to synthesize new penicillins containing keto acids as side chains. It is also used to study the various metabolic pathways of 4-hydroxypentanoate and Levulinate. It is also used as an Pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29181990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |






