A6557312
Oryzalin , 95% , 19044-88-3
CAS NO.:19044-88-3
Empirical Formula: C12H18N4O6S
Molecular Weight: 346.36
MDL number: MFCD00078725
EINECS: 242-777-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB220.00 | In Stock |
|
| 1G | RMB659.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141°C |
| Boiling point: | 514.0±60.0 °C(Predicted) |
| Density | 1.2 |
| refractive index | 1.6000 (estimate) |
| storage temp. | 0-6°C |
| solubility | DMSO : 250 mg/mL (721.79 mM; Need ultrasonic) |
| form | Crystalline Solid |
| pka | 9.14±0.60(Predicted) |
| color | Deep orange |
| Water Solubility | 85mg/L(25 ºC) |
| BRN | 2177305 |
| Henry's Law Constant | 5.2×103 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | agriculture environmental |
| InChI | 1S/C12H18N4O6S/c1-3-5-14(6-4-2)12-10(15(17)18)7-9(23(13,21)22)8-11(12)16(19)20/h7-8H,3-6H2,1-2H3,(H2,13,21,22) |
| InChIKey | UNAHYJYOSSSJHH-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)c1c(cc(cc1[N+]([O-])=O)S(N)(=O)=O)[N+]([O-])=O |
| LogP | 3.730 |
| CAS DataBase Reference | 19044-88-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Oryzalin(19044-88-3) |
| EPA Substance Registry System | Oryzalin (19044-88-3) |
Description and Uses
Oryzalin is a pre-emergence surface-applied herbicide. It has a low aqueous solubility, is not volatile and, based on its chemical properties, is not expected to leach to groundwater. However, groundwater monitoring programmes have identified it as a pollutant. It generally tends not to be persistent in soil or water systems. It has a low mammalian toxicity and is a potential carcinogen. It is moderately toxic to birds, most aquatic organisms, honeybees and earthworms.
Herbicide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H351-H373-H410 |
| Precautionary statements | P202-P260-P273-P280-P302+P352-P308+P313 |
| target organs | Blood,Kidney |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 51/53 |
| Safety Statements | 60 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| RTECS | WO9350000 |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Skin Sens. 1 STOT RE 2 |
| Hazardous Substances Data | 19044-88-3(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: >10 g/kg (Decker, Johnson) |







