A6568012
2,2,3,3,4,4,5,5-Octafluoro-1-pentanol , >98.0%(GC) , 355-80-6
CAS NO.:355-80-6
Empirical Formula: C5H4F8O
Molecular Weight: 232.07
MDL number: MFCD00039631
EINECS: 206-593-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB33.60 | In Stock |
|
| 25G | RMB54.40 | In Stock |
|
| 100G | RMB158.40 | In Stock |
|
| 500G | RMB751.20 | In Stock |
|
| 2.5kg | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-50°C |
| Boiling point: | 141-142 °C (lit.) |
| Density | 1.667 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 168 °F |
| storage temp. | 2-8°C |
| form | liquid |
| pka | 12.91±0.10(Predicted) |
| color | colorless |
| Specific Gravity | 1.667 |
| Water Solubility | insoluble |
| Merck | 14,6746 |
| BRN | 1773494 |
| InChI | 1S/C5H4F8O/c6-2(7)4(10,11)5(12,13)3(8,9)1-14/h2,14H,1H2 |
| InChIKey | JUGSKHLZINSXPQ-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| CAS DataBase Reference | 355-80-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Pentanol, 2,2,3,3,4,4,5,5-octafluoro-(355-80-6) |
| EPA Substance Registry System | 1-Pentanol, 2,2,3,3,4,4,5,5-octafluoro- (355-80-6) |
Description and Uses
2,2,3,3,4,4,5,5-Octafluoro-1-pentanol is used as a cosurfactant in the synthesis of silver and silver iodide nanocrystals. It was also used in the synthesis of Ag2S nanocrystals with a characteristic surface plasmon resonance absorption at 330nm.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227-H335 |
| Precautionary statements | P210e-P261-P280a-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | SA7650000 |
| Hazard Note | Flammable |
| TSCA | TSCA listed |
| HS Code | 29055910 |
| Storage Class | 10 - Combustible liquids |
| Toxicity | LCLo ihl-rat: 2500 ppm/4H JOCMA7 4,262,62 |



