A6596512
4-oxocyclohexane-1-carboxylic acid , 97% , 874-61-3
Synonym(s):
4-Ketocyclohexanecarboxylic acid;Cyclohexanone-4-carboxylic acid
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB33.60 | In Stock |
|
| 1G | RMB78.40 | In Stock |
|
| 5G | RMB227.20 | In Stock |
|
| 25G | RMB833.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-71℃ |
| Boiling point: | 210 °C(Press: 25 Torr) |
| Density | 1.233±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 4.43±0.20(Predicted) |
| color | Off-White |
| InChI | InChI=1S/C7H10O3/c8-6-3-1-5(2-4-6)7(9)10/h5H,1-4H2,(H,9,10) |
| InChIKey | OWLXUYGCLDGHJJ-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)CCC(=O)CC1 |
| CAS DataBase Reference | 874-61-3(CAS DataBase Reference) |
Description and Uses
4-Oxocyclohexanecarboxylic Acid is used in the preparation of Indomethacin (I641000) analogues used in the treatment of prostate cancer. In addition it is used in the synthesis of β-alanine derivatives as glucagon receptor antagonists.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |




