A6599212
1-Octanesulfonic acid sodium salt monohydrate , 98% , 207596-29-0
Synonym(s):
1-Octanesulfonic acid sodium salt monohydrate
CAS NO.:207596-29-0
Empirical Formula: C8H21NaO4S
Molecular Weight: 236.3
MDL number: MFCD00149551
EINECS: 695-274-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.80 | In Stock |
|
| 5G | RMB60.80 | In Stock |
|
| 25g | RMB211.20 | In Stock |
|
| 100g | RMB683.20 | In Stock |
|
| 500G | RMB2656.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: soluble0.1g/mL, clear, colorless |
| form | Fine Powder |
| color | White |
| PH Range | 5.5 - 7.5 |
| Water Solubility | Soluble in water. |
| λmax | λ: 210 nm Amax: 0.1 λ: 220 nm Amax: 0.06 λ: 230 nm Amax: 0.04 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 |
| BRN | 3574241 |
| InChI | InChI=1S/C8H18O3S.Na.H2O.H/c1-2-3-4-5-6-7-8-12(9,10)11;;;/h2-8H2,1H3,(H,9,10,11);;1H2; |
| InChIKey | BQAODTSTHHSQHJ-UHFFFAOYSA-N |
| SMILES | C(S(O)(=O)=O)CCCCCCC.[NaH].O |
| CAS DataBase Reference | 207596-29-0(CAS DataBase Reference) |
Description and Uses
1-Octanesulfonic acid sodium salt monohydrate (cas# 207596-29-0) is useful in hydrophobic ion pairing of peptide antibiotics for processing into controlled release nanocarrier formulations.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29041000 |




![Sodium 1-Tridecanesulfonate [Reagent for Ion-Pair Chromatography]](https://img.chemicalbook.com/CAS/GIF/5802-89-1.gif)
