A6621112
L-Phenylalanine tert-butyl ester hydrochloride , 99% , 15100-75-1
CAS NO.:15100-75-1
Empirical Formula: C13H20ClNO2
Molecular Weight: 257.76
MDL number: MFCD00038894
EINECS: 239-151-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25g | RMB159.20 | In Stock |
|
| 100g | RMB511.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240℃ |
| storage temp. | 2-8°C |
| solubility | Soluble in methanol. |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]20/D +47.0±1°, c = 2% in ethanol |
| Sensitive | Hygroscopic |
| BRN | 4723424 |
| Major Application | peptide synthesis |
| InChI | 1S/C13H19NO2.ClH/c1-13(2,3)16-12(15)11(14)9-10-7-5-4-6-8-10;/h4-8,11H,9,14H2,1-3H3;1H/t11-;/m0./s1 |
| InChIKey | FDMCEXDXULPJPG-MERQFXBCSA-N |
| SMILES | Cl.CC(C)(C)OC(=O)[C@@H](N)Cc1ccccc1 |
| CAS DataBase Reference | 15100-75-1(CAS DataBase Reference) |
Description and Uses
L-Phenylalanine tert-Butyl Ester is an derivative of L-Phenylalanine (P319415), an essential amino acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 3 |
| Storage Class | 11 - Combustible Solids |






