PRODUCT Properties
| Melting point: | 282 °C (dec.)(lit.) | 
                                    
| Boiling point: | 239.22°C (rough estimate) | 
                                    
| Density | 1.1426 (rough estimate) | 
                                    
| refractive index | 1.4300 (estimate) | 
                                    
| storage temp. | Store at RT. | 
                                    
| solubility | Methanol (Slightly), Water (Slightly) | 
                                    
| form | Solid | 
                                    
| color | White to Off-White | 
                                    
| InChI | InChI=1S/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9) | 
                                    
| InChIKey | HXEACLLIILLPRG-UHFFFAOYSA-N | 
                                    
| SMILES | C1(C(=O)O)NCCCC1 | 
                                    
| CAS DataBase Reference | 4043-87-2(CAS DataBase Reference) | 
                                    
| NIST Chemistry Reference | Pipecolic acid(4043-87-2) | 
                                    
Description and Uses
Pipecolic acid is involved in synaptic transmission in the central nervous system.





