A6632412
(Phenylthio)acetic acid , 98% , 103-04-8
Synonym(s):
(Phenylmercapto)acetic acid;S-Phenylthioglycolic acid;Thiophenoxyacetic acid
CAS NO.:103-04-8
Empirical Formula: C8H8O2S
Molecular Weight: 168.21
MDL number: MFCD00004355
EINECS: 203-073-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB41.60 | In Stock |
|
| 25G | RMB197.60 | In Stock |
|
| 100G | RMB691.20 | In Stock |
|
| 500g | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-63 °C (lit.) |
| Boiling point: | 314.4±25.0 °C(Predicted) |
| Density | 1.27±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| pka | 3.70±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2045072 |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChI | InChI=1S/C8H8O2S/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) |
| InChIKey | MOTOSAGBNXXRRE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CSC1=CC=CC=C1 |
| CAS DataBase Reference | 103-04-8(CAS DataBase Reference) |
| EPA Substance Registry System | (Phenylthio)acetic acid (103-04-8) |
Description and Uses
(Phenylthio)acetic acid is a reactant in the preparation of benzoxazoles, benzimidazoles, and benzothiazoles, which exhibit antimicrobial activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HazardClass | 9 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







