A6633512
2-Phenylisobutyric Acid , 98% , 826-55-1
CAS NO.：826-55-1
Empirical Formula: C10H12O2
Molecular Weight: 164.2
MDL number: MFCD00014332
EINECS: 212-556-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB91.20 | In Stock |
|
| 500g | RMB471.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-82°C |
| Boiling point: | 146.5°C |
| Density | 1.089±0.06 g/cm3(Predicted) |
| Flash point: | 146.5°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.39±0.10(Predicted) |
| form | Crystalline |
| color | White |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C10H12O2/c1-10(2,9(11)12)8-6-4-3-5-7-8/h3-7H,1-2H3,(H,11,12) |
| InChIKey | YYEROYLAYAVZNW-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1)C(C)(C)C(=O)O |
| LogP | 2.3 at 20℃ |
| CAS DataBase Reference | 826-55-1(CAS DataBase Reference) |
Description and Uses
Used in the synthesis of Fexofenadine hydrochloride (F322470).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2916399090 |
