A6635212
4-(4-Pyridyl)benzoic acid , 98% , 4385-76-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB44.00 | In Stock |
|
| 1G | RMB135.20 | In Stock |
|
| 5G | RMB524.80 | In Stock |
|
| 25G | RMB1992.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| Boiling point: | 384.3±25.0 °C(Predicted) |
| Density | 1.241±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | solid |
| pka | 3+-.0.10(Predicted) |
| Appearance | White to off-white Solid |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C12H9NO2/c14-12(15)11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-8H,(H,14,15) |
| InChIKey | DZLGZIGLHCRIMF-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(C2C=CN=CC=2)C=C1 |
| CAS DataBase Reference | 4385-76-6(CAS DataBase Reference) |
Description and Uses
4-Pyrid-4-ylbenzoic acid is used as a ligand in the synthesis of MOF materials, such as: UTSA-36; Co(pybz)2.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-22-37 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |





